C31H24F3NO3S — CID 13416663
9-phenyl-10-[2-(2,4,6-trimethylphenyl)ethynyl]acridin-10-ium;trifluoromethanesulfonate (PubChem CID 13416663) has the molecular formula C31H24F3NO3S and a molecular weight of 547.60 g/mol. Its IUPAC name is 9-phenyl-10-[2-(2,4,6-trimethylphenyl)ethynyl]acridin-10-ium;trifluoromethanesulfonate.
| Compound Name | 9-phenyl-10-[2-(2,4,6-trimethylphenyl)ethynyl]acridin-10-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 13416663 |
| Molecular Formula | C31H24F3NO3S |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 9-phenyl-10-[2-(2,4,6-trimethylphenyl)ethynyl]acridin-10-ium;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(C#C[n+]2c3ccccc3c(-c3ccccc3)c3ccccc32)c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C30H24N.CHF3O3S/c1-21-19-22(2)25(23(3)20-21)17-18-31-28-15-9-7-13-26(28)30(24-11-5-4-6-12-24)27-14-8-10-16-29(27)31;2-1(3,4)8(5,6)7/h4-16,19-20H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FICRPXYUXUSMIT-UHFFFAOYSA-M |
| XLogP | 6.78 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|