C12H20N2S2 — CID 134171694
4-hexan-3-yl-2,6-bis(methylsulfanyl)pyrimidine (PubChem CID 134171694) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is 4-hexan-3-yl-2,6-bis(methylsulfanyl)pyrimidine.
| Compound Name | 4-hexan-3-yl-2,6-bis(methylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 134171694 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-hexan-3-yl-2,6-bis(methylsulfanyl)pyrimidine |
| SMILES | CCCC(CC)c1cc(SC)nc(SC)n1 |
| InChI | InChI=1S/C12H20N2S2/c1-5-7-9(6-2)10-8-11(15-3)14-12(13-10)16-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | RQFPMORMGFCKAB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |