C8H12N2S2 — CID 130708904
4-ethyl-2,6-bis(methylsulfanyl)pyrimidine (PubChem CID 130708904) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-ethyl-2,6-bis(methylsulfanyl)pyrimidine.
| Compound Name | 4-ethyl-2,6-bis(methylsulfanyl)pyrimidine |
|---|---|
| PubChem CID | 130708904 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-ethyl-2,6-bis(methylsulfanyl)pyrimidine |
| SMILES | CCc1cc(SC)nc(SC)n1 |
| InChI | InChI=1S/C8H12N2S2/c1-4-6-5-7(11-2)10-8(9-6)12-3/h5H,4H2,1-3H3 |
| InChIKey | OZAYDVYQDZPMHQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |