C35H39FN8O3 — CID 134172791
1-[3-tert-butyl-1-(3-fluoro-5-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 134172791) has the molecular formula C35H39FN8O3 and a molecular weight of 638.75 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(3-fluoro-5-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(3-fluoro-5-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 134172791 |
| Molecular Formula | C35H39FN8O3 |
| Molecular Weight | 638.75 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | 1-[3-tert-butyl-1-(3-fluoro-5-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)N[C@H]2CC[C@@H](Oc3ccc4nnc(N5CCCCC5)n4c3)c3ccccc32)n(-c2cc(O)cc(F)c2)n1 |
| InChI | InChI=1S/C35H39FN8O3/c1-35(2,3)30-20-32(44(41-30)23-17-22(36)18-24(45)19-23)38-33(46)37-28-12-13-29(27-10-6-5-9-26(27)28)47-25-11-14-31-39-40-34(43(31)21-25)42-15-7-4-8-16-42/h5-6,9-11,14,17-21,28-29,45H,4,7-8,12-13,15-16H2,1-3H3,(H2,37,38,46)/t28-,29+/m0/s1 |
| InChIKey | CHTZUDFXYJIQNS-URLMMPGGSA-N |
| XLogP | 6.82 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |