C18H15N — CID 134173102
N-cyclopenta-1,2,4-trien-1-yl-3-methyl-N-phenylaniline (PubChem CID 134173102) has the molecular formula C18H15N and a molecular weight of 245.32 g/mol. Its IUPAC name is N-cyclopenta-1,2,4-trien-1-yl-3-methyl-N-phenylaniline.
| Compound Name | N-cyclopenta-1,2,4-trien-1-yl-3-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 134173102 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-cyclopenta-1,2,4-trien-1-yl-3-methyl-N-phenylaniline |
| SMILES | Cc1cccc(N(C2=C=CC=C2)c2ccccc2)c1 |
| InChI | InChI=1S/C18H15N/c1-15-8-7-13-18(14-15)19(17-11-5-6-12-17)16-9-3-2-4-10-16/h2-11,13-14H,1H3 |
| InChIKey | PNPPRTVKWIZWPG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |