C18H33NO2S — CID 134175279
3-[(2R)-2,3-dimethylbutyl]sulfanyl-1-(5,5-dimethylhexyl)pyrrolidine-2,5-dione (PubChem CID 134175279) has the molecular formula C18H33NO2S and a molecular weight of 327.53 g/mol. Its IUPAC name is 3-[(2R)-2,3-dimethylbutyl]sulfanyl-1-(5,5-dimethylhexyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(2R)-2,3-dimethylbutyl]sulfanyl-1-(5,5-dimethylhexyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134175279 |
| Molecular Formula | C18H33NO2S |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 3-[(2R)-2,3-dimethylbutyl]sulfanyl-1-(5,5-dimethylhexyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)[C@@H](C)CSC1CC(=O)N(CCCCC(C)(C)C)C1=O |
| InChI | InChI=1S/C18H33NO2S/c1-13(2)14(3)12-22-15-11-16(20)19(17(15)21)10-8-7-9-18(4,5)6/h13-15H,7-12H2,1-6H3/t14-,15?/m0/s1 |
| InChIKey | BKDVMVRNVQWCEQ-MLCCFXAWSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|