C23H30BrN7 — CID 134176916
6-bromo-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine (PubChem CID 134176916) has the molecular formula C23H30BrN7 and a molecular weight of 484.45 g/mol. Its IUPAC name is 6-bromo-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 6-bromo-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134176916 |
| Molecular Formula | C23H30BrN7 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 6-bromo-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(1-methylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine |
| SMILES | CN1CCC(Nc2c(Br)cnc3nc(-c4ccc(N5CCN(C)CC5)cc4)[nH]c23)CC1 |
| InChI | InChI=1S/C23H30BrN7/c1-29-9-7-17(8-10-29)26-20-19(24)15-25-23-21(20)27-22(28-23)16-3-5-18(6-4-16)31-13-11-30(2)12-14-31/h3-6,15,17H,7-14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | XUKJJTXQRSEBTR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|