C28H39BrN6O — CID 134177011
6-bromo-2-[4-[4-(2-ethoxyethyl)piperidin-1-yl]phenyl]-N-(1-ethylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine (PubChem CID 134177011) has the molecular formula C28H39BrN6O and a molecular weight of 555.57 g/mol. Its IUPAC name is 6-bromo-2-[4-[4-(2-ethoxyethyl)piperidin-1-yl]phenyl]-N-(1-ethylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 6-bromo-2-[4-[4-(2-ethoxyethyl)piperidin-1-yl]phenyl]-N-(1-ethylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134177011 |
| Molecular Formula | C28H39BrN6O |
| Molecular Weight | 555.57 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 6-bromo-2-[4-[4-(2-ethoxyethyl)piperidin-1-yl]phenyl]-N-(1-ethylpiperidin-4-yl)-1H-imidazo[4,5-b]pyridin-7-amine |
| SMILES | CCOCCC1CCN(c2ccc(-c3nc4ncc(Br)c(NC5CCN(CC)CC5)c4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C28H39BrN6O/c1-3-34-14-11-22(12-15-34)31-25-24(29)19-30-28-26(25)32-27(33-28)21-5-7-23(8-6-21)35-16-9-20(10-17-35)13-18-36-4-2/h5-8,19-20,22H,3-4,9-18H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | ZBXVKKZHYZPOKM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|