C28H35ClN8O2 — CID 134177468
3-[4-[[6-chloro-2-[4-[4-(2-ethoxyethyl)-3-oxopiperazin-1-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]piperidin-1-yl]propanenitrile (PubChem CID 134177468) has the molecular formula C28H35ClN8O2 and a molecular weight of 551.10 g/mol. Its IUPAC name is 3-[4-[[6-chloro-2-[4-[4-(2-ethoxyethyl)-3-oxopiperazin-1-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]piperidin-1-yl]propanenitrile.
| Compound Name | 3-[4-[[6-chloro-2-[4-[4-(2-ethoxyethyl)-3-oxopiperazin-1-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]piperidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 134177468 |
| Molecular Formula | C28H35ClN8O2 |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 3-[4-[[6-chloro-2-[4-[4-(2-ethoxyethyl)-3-oxopiperazin-1-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]piperidin-1-yl]propanenitrile |
| SMILES | CCOCCN1CCN(c2ccc(-c3nc4ncc(Cl)c(NC5CCN(CCC#N)CC5)c4[nH]3)cc2)CC1=O |
| InChI | InChI=1S/C28H35ClN8O2/c1-2-39-17-16-36-14-15-37(19-24(36)38)22-6-4-20(5-7-22)27-33-26-25(23(29)18-31-28(26)34-27)32-21-8-12-35(13-9-21)11-3-10-30/h4-7,18,21H,2-3,8-9,11-17,19H2,1H3,(H2,31,32,33,34) |
| InChIKey | MSEPQEJHEJCHQQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|