C30H42ClN7O2 — CID 134177324
4-[4-[6-chloro-7-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(2-ethoxyethyl)piperazin-2-one (PubChem CID 134177324) has the molecular formula C30H42ClN7O2 and a molecular weight of 568.17 g/mol. Its IUPAC name is 4-[4-[6-chloro-7-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(2-ethoxyethyl)piperazin-2-one.
| Compound Name | 4-[4-[6-chloro-7-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(2-ethoxyethyl)piperazin-2-one |
|---|---|
| PubChem CID | 134177324 |
| Molecular Formula | C30H42ClN7O2 |
| Molecular Weight | 568.17 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | 4-[4-[6-chloro-7-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(2-ethoxyethyl)piperazin-2-one |
| SMILES | CCOCCN1CCN(c2ccc(-c3nc4ncc(Cl)c(NC5CC(C)(C)N(C)C(C)(C)C5)c4[nH]3)cc2)CC1=O |
| InChI | InChI=1S/C30H42ClN7O2/c1-7-40-15-14-37-12-13-38(19-24(37)39)22-10-8-20(9-11-22)27-34-26-25(23(31)18-32-28(26)35-27)33-21-16-29(2,3)36(6)30(4,5)17-21/h8-11,18,21H,7,12-17,19H2,1-6H3,(H2,32,33,34,35) |
| InChIKey | DCLOMRKLJBCLFV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|