C33H40ClN7O3 — CID 134177001
4-[4-[6-chloro-7-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(3-methoxypropyl)piperazin-2-one (PubChem CID 134177001) has the molecular formula C33H40ClN7O3 and a molecular weight of 618.18 g/mol. Its IUPAC name is 4-[4-[6-chloro-7-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(3-methoxypropyl)piperazin-2-one.
| Compound Name | 4-[4-[6-chloro-7-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(3-methoxypropyl)piperazin-2-one |
|---|---|
| PubChem CID | 134177001 |
| Molecular Formula | C33H40ClN7O3 |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 4-[4-[6-chloro-7-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl]-1-(3-methoxypropyl)piperazin-2-one |
| SMILES | COCCCN1CCN(c2ccc(-c3nc4ncc(Cl)c(NC5CCN(Cc6ccc(OC)cc6)CC5)c4[nH]3)cc2)CC1=O |
| InChI | InChI=1S/C33H40ClN7O3/c1-43-19-3-14-40-17-18-41(22-29(40)42)26-8-6-24(7-9-26)32-37-31-30(28(34)20-35-33(31)38-32)36-25-12-15-39(16-13-25)21-23-4-10-27(44-2)11-5-23/h4-11,20,25H,3,12-19,21-22H2,1-2H3,(H2,35,36,37,38) |
| InChIKey | ZXJYTKTZYLDNIU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|