C17H21N7O — CID 134177596
[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 134177596) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 134177596 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cnccn2)nc1)N1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C17H21N7O/c25-16(24-7-6-23-5-1-2-15(23)12-24)13-8-20-17(21-9-13)22-11-14-10-18-3-4-19-14/h3-4,8-10,15H,1-2,5-7,11-12H2,(H,20,21,22)/t15-/m1/s1 |
| InChIKey | SPGDEVJYSLOMRW-OAHLLOKOSA-N |
| XLogP | 0.80 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |