C17H19F2N7O — CID 139580304
[(8aS)-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 139580304) has the molecular formula C17H19F2N7O and a molecular weight of 375.38 g/mol. Its IUPAC name is [(8aS)-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(8aS)-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580304 |
| Molecular Formula | C17H19F2N7O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [(8aS)-7,7-difluoro-1,3,4,6,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cnccn2)nc1)N1CCN2CC(F)(F)C[C@H]2C1 |
| InChI | InChI=1S/C17H19F2N7O/c18-17(19)5-14-10-25(3-4-26(14)11-17)15(27)12-6-22-16(23-7-12)24-9-13-8-20-1-2-21-13/h1-2,6-8,14H,3-5,9-11H2,(H,22,23,24)/t14-/m0/s1 |
| InChIKey | YPVIWGDXLQPBCJ-AWEZNQCLSA-N |
| XLogP | 1.04 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |