C50H35N3S2 — CID 134179108
25-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-3,10-dithia-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18-nonaene (PubChem CID 134179108) has the molecular formula C50H35N3S2 and a molecular weight of 741.99 g/mol. Its IUPAC name is 25-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-3,10-dithia-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18-nonaene.
| Compound Name | 25-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-3,10-dithia-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18-nonaene |
|---|---|
| PubChem CID | 134179108 |
| Molecular Formula | C50H35N3S2 |
| Molecular Weight | 741.99 g/mol |
| Exact Mass | 741.23 |
| IUPAC Name | 25-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-3,10-dithia-25-azahexacyclo[12.11.0.02,11.04,9.015,24.017,22]pentacosa-1(14),2(11),4,6,8,12,15(24),16,18-nonaene |
| SMILES | C1=CC2=Cc3c(n(-c4cccc(-c5cccc(-c6cc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)c4c5c(ccc34)Sc3ccccc3S5)CC2CC1 |
| InChI | InChI=1S/C50H35N3S2/c1-3-13-32(14-4-1)42-31-43(52-50(51-42)33-15-5-2-6-16-33)38-21-11-19-34(27-38)35-20-12-22-39(28-35)53-44-30-37-18-8-7-17-36(37)29-41(44)40-25-26-47-49(48(40)53)55-46-24-10-9-23-45(46)54-47/h1-7,9-17,19-29,31,37H,8,18,30H2 |
| InChIKey | USVSVZDHDXSKDY-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.99 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |