C32H31FN4O3 — CID 134179828
[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-cyanophenyl] 3-methoxypropanoate (PubChem CID 134179828) has the molecular formula C32H31FN4O3 and a molecular weight of 538.62 g/mol. Its IUPAC name is [2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-cyanophenyl] 3-methoxypropanoate.
| Compound Name | [2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-cyanophenyl] 3-methoxypropanoate |
|---|---|
| PubChem CID | 134179828 |
| Molecular Formula | C32H31FN4O3 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | [2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-cyanophenyl] 3-methoxypropanoate |
| SMILES | COCCC(=O)Oc1c(C#N)cccc1-c1ccc2ncc(-c3cc(C)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C32H31FN4O3/c1-20-14-23(16-24(33)15-20)28-19-36-29-7-6-21(17-27(29)31(28)37-11-8-25(35)9-12-37)26-5-3-4-22(18-34)32(26)40-30(38)10-13-39-2/h3-7,14-17,19,25H,8-13,35H2,1-2H3 |
| InChIKey | FGVTWXDXLMZXAP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|