C30H28F2N4O3 — CID 140844138
3-[4-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-(methoxymethoxy)benzonitrile (PubChem CID 140844138) has the molecular formula C30H28F2N4O3 and a molecular weight of 530.58 g/mol. Its IUPAC name is 3-[4-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-(methoxymethoxy)benzonitrile.
| Compound Name | 3-[4-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-(methoxymethoxy)benzonitrile |
|---|---|
| PubChem CID | 140844138 |
| Molecular Formula | C30H28F2N4O3 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3-[4-[(3R,4S)-4-amino-3-methoxypiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-(methoxymethoxy)benzonitrile |
| SMILES | COCOc1c(C#N)cccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CC[C@H](N)[C@H](OC)C3)c2c1 |
| InChI | InChI=1S/C30H28F2N4O3/c1-37-17-39-30-19(14-33)4-3-5-23(30)18-6-7-27-24(12-18)29(36-9-8-26(34)28(16-36)38-2)25(15-35-27)20-10-21(31)13-22(32)11-20/h3-7,10-13,15,26,28H,8-9,16-17,34H2,1-2H3/t26-,28+/m0/s1 |
| InChIKey | YZICXZWMZPMDCN-XTEPFMGCSA-N |
| XLogP | 5.25 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|