C29H24BrF2N3O2 — CID 140837054
3-[4-[3-(bromomethyl)azetidin-1-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-fluoro-2-(methoxymethoxy)benzonitrile (PubChem CID 140837054) has the molecular formula C29H24BrF2N3O2 and a molecular weight of 564.43 g/mol. Its IUPAC name is 3-[4-[3-(bromomethyl)azetidin-1-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-fluoro-2-(methoxymethoxy)benzonitrile.
| Compound Name | 3-[4-[3-(bromomethyl)azetidin-1-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-fluoro-2-(methoxymethoxy)benzonitrile |
|---|---|
| PubChem CID | 140837054 |
| Molecular Formula | C29H24BrF2N3O2 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 3-[4-[3-(bromomethyl)azetidin-1-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-5-fluoro-2-(methoxymethoxy)benzonitrile |
| SMILES | COCOc1c(C#N)cc(F)cc1-c1ccc2ncc(-c3cc(C)cc(F)c3)c(N3CC(CBr)C3)c2c1 |
| InChI | InChI=1S/C29H24BrF2N3O2/c1-17-5-20(7-22(31)6-17)26-13-34-27-4-3-19(9-25(27)28(26)35-14-18(11-30)15-35)24-10-23(32)8-21(12-33)29(24)37-16-36-2/h3-10,13,18H,11,14-16H2,1-2H3 |
| InChIKey | IIDXQAJMWKVYOQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|