C30H29FN4O — CID 140836985
3-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile (PubChem CID 140836985) has the molecular formula C30H29FN4O and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile.
| Compound Name | 3-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 140836985 |
| Molecular Formula | C30H29FN4O |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 3-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile |
| SMILES | CCCNCC1CN(c2c(-c3cc(C)cc(F)c3)cnc3ccc(-c4cccc(C#N)c4O)cc23)C1 |
| InChI | InChI=1S/C30H29FN4O/c1-3-9-33-15-20-17-35(18-20)29-26-13-21(25-6-4-5-22(14-32)30(25)36)7-8-28(26)34-16-27(29)23-10-19(2)11-24(31)12-23/h4-8,10-13,16,20,33,36H,3,9,15,17-18H2,1-2H3 |
| InChIKey | DWSUYFFOICPILC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|