C29H28F3N3O — CID 140837134
3,6-difluoro-2-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]phenol (PubChem CID 140837134) has the molecular formula C29H28F3N3O and a molecular weight of 491.56 g/mol. Its IUPAC name is 3,6-difluoro-2-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]phenol.
| Compound Name | 3,6-difluoro-2-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]phenol |
|---|---|
| PubChem CID | 140837134 |
| Molecular Formula | C29H28F3N3O |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 3,6-difluoro-2-[3-(3-fluoro-5-methylphenyl)-4-[3-(propylaminomethyl)azetidin-1-yl]quinolin-6-yl]phenol |
| SMILES | CCCNCC1CN(c2c(-c3cc(C)cc(F)c3)cnc3ccc(-c4c(F)ccc(F)c4O)cc23)C1 |
| InChI | InChI=1S/C29H28F3N3O/c1-3-8-33-13-18-15-35(16-18)28-22-12-19(27-24(31)5-6-25(32)29(27)36)4-7-26(22)34-14-23(28)20-9-17(2)10-21(30)11-20/h4-7,9-12,14,18,33,36H,3,8,13,15-16H2,1-2H3 |
| InChIKey | SLMATAOCEFFAGE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|