C28H26F2N4O2 — CID 134168318
(3S,4R)-4-amino-1-[6-[3-fluoro-2-[(E)-hydroxyiminomethyl]phenyl]-3-(3-fluoro-5-methylphenyl)quinolin-4-yl]piperidin-3-ol (PubChem CID 134168318) has the molecular formula C28H26F2N4O2 and a molecular weight of 488.54 g/mol. Its IUPAC name is (3S,4R)-4-amino-1-[6-[3-fluoro-2-[(E)-hydroxyiminomethyl]phenyl]-3-(3-fluoro-5-methylphenyl)quinolin-4-yl]piperidin-3-ol.
| Compound Name | (3S,4R)-4-amino-1-[6-[3-fluoro-2-[(E)-hydroxyiminomethyl]phenyl]-3-(3-fluoro-5-methylphenyl)quinolin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 134168318 |
| Molecular Formula | C28H26F2N4O2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (3S,4R)-4-amino-1-[6-[3-fluoro-2-[(E)-hydroxyiminomethyl]phenyl]-3-(3-fluoro-5-methylphenyl)quinolin-4-yl]piperidin-3-ol |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4cccc(F)c4/C=N/O)cc3c2N2CC[C@@H](N)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C28H26F2N4O2/c1-16-9-18(11-19(29)10-16)22-13-32-26-6-5-17(20-3-2-4-24(30)23(20)14-33-36)12-21(26)28(22)34-8-7-25(31)27(35)15-34/h2-6,9-14,25,27,35-36H,7-8,15,31H2,1H3/b33-14+/t25-,27+/m1/s1 |
| InChIKey | WESBXBDTMSTIFL-HSOYDPAJSA-N |
| XLogP | 4.86 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|