C27H23F3N4O — CID 140837106
N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine (PubChem CID 140837106) has the molecular formula C27H23F3N4O and a molecular weight of 476.50 g/mol. Its IUPAC name is N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine.
| Compound Name | N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 140837106 |
| Molecular Formula | C27H23F3N4O |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-6-fluorophenyl]methylidene]hydroxylamine |
| SMILES | NC1CCN(c2c(-c3cc(F)cc(F)c3)cnc3ccc(-c4cccc(F)c4C=NO)cc23)CC1 |
| InChI | InChI=1S/C27H23F3N4O/c28-18-10-17(11-19(29)13-18)23-14-32-26-5-4-16(21-2-1-3-25(30)24(21)15-33-35)12-22(26)27(23)34-8-6-20(31)7-9-34/h1-5,10-15,20,35H,6-9,31H2 |
| InChIKey | FGDFFXABWRUDRT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|