C26H23F2N5O — CID 146676584
(NE)-N-[[4-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 146676584) has the molecular formula C26H23F2N5O and a molecular weight of 459.50 g/mol. Its IUPAC name is (NE)-N-[[4-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 146676584 |
| Molecular Formula | C26H23F2N5O |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (NE)-N-[[4-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | NC1CCN(c2c(-c3cc(F)cc(F)c3)cnc3ccc(-c4ccnc(/C=N/O)c4)cc23)CC1 |
| InChI | InChI=1S/C26H23F2N5O/c27-19-9-18(10-20(28)13-19)24-15-31-25-2-1-16(17-3-6-30-22(11-17)14-32-34)12-23(25)26(24)33-7-4-21(29)5-8-33/h1-3,6,9-15,21,34H,4-5,7-8,29H2/b32-14+ |
| InChIKey | CHKNAHXXPPNOMM-HIWRWHBISA-N |
| XLogP | 4.98 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|