C26H22F3N5O — CID 146676574
(NE)-N-[[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-5-fluoro-4-pyridinyl]methylidene]hydroxylamine (PubChem CID 146676574) has the molecular formula C26H22F3N5O and a molecular weight of 477.49 g/mol. Its IUPAC name is (NE)-N-[[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-5-fluoro-4-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-5-fluoro-4-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 146676574 |
| Molecular Formula | C26H22F3N5O |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (NE)-N-[[3-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-5-fluoro-4-pyridinyl]methylidene]hydroxylamine |
| SMILES | NC1CCN(c2c(-c3cc(F)cc(F)c3)cnc3ccc(-c4cncc(F)c4/C=N/O)cc23)CC1 |
| InChI | InChI=1S/C26H22F3N5O/c27-17-7-16(8-18(28)10-17)22-12-32-25-2-1-15(21-11-31-14-24(29)23(21)13-33-35)9-20(25)26(22)34-5-3-19(30)4-6-34/h1-2,7-14,19,35H,3-6,30H2/b33-13+ |
| InChIKey | MBBXCEPWQDWOOT-IIHBXENTSA-N |
| XLogP | 5.12 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|