C31H31FN4O3 — CID 146676594
2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-[(E)-methoxyiminomethyl]phenol (PubChem CID 146676594) has the molecular formula C31H31FN4O3 and a molecular weight of 526.61 g/mol. Its IUPAC name is 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-[(E)-methoxyiminomethyl]phenol.
| Compound Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-[(E)-methoxyiminomethyl]phenol |
|---|---|
| PubChem CID | 146676594 |
| Molecular Formula | C31H31FN4O3 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-6-[(E)-methoxyiminomethyl]phenol |
| SMILES | CO/N=C/c1cccc(-c2ccc3ncc(-c4cc(C)cc(F)c4)c(N4CC[C@H]5OCCN[C@@H]5C4)c3c2)c1O |
| InChI | InChI=1S/C31H31FN4O3/c1-19-12-22(14-23(32)13-19)26-17-34-27-7-6-20(24-5-3-4-21(31(24)37)16-35-38-2)15-25(27)30(26)36-10-8-29-28(18-36)33-9-11-39-29/h3-7,12-17,28-29,33,37H,8-11,18H2,1-2H3/b35-16+/t28-,29-/m1/s1 |
| InChIKey | AMVNILZKRBGCBA-WSYJMDPWSA-N |
| XLogP | 5.27 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|