C26H28FN3O2 — CID 118308011
5-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-5-(3-fluoro-5-methylphenyl)-3-pyridinyl]-2-methylphenol (PubChem CID 118308011) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 5-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-5-(3-fluoro-5-methylphenyl)-3-pyridinyl]-2-methylphenol.
| Compound Name | 5-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-5-(3-fluoro-5-methylphenyl)-3-pyridinyl]-2-methylphenol |
|---|---|
| PubChem CID | 118308011 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-5-(3-fluoro-5-methylphenyl)-3-pyridinyl]-2-methylphenol |
| SMILES | Cc1cc(F)cc(-c2cncc(-c3ccc(C)c(O)c3)c2N2CC[C@H]3NCCO[C@@H]3C2)c1 |
| InChI | InChI=1S/C26H28FN3O2/c1-16-9-19(11-20(27)10-16)22-14-28-13-21(18-4-3-17(2)24(31)12-18)26(22)30-7-5-23-25(15-30)32-8-6-29-23/h3-4,9-14,23,25,29,31H,5-8,15H2,1-2H3/t23-,25-/m1/s1 |
| InChIKey | GOOMIBHCZNLJGE-ILBGXUMGSA-N |
| XLogP | 4.44 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |