C27H25F2N5O2 — CID 155295580
5-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 155295580) has the molecular formula C27H25F2N5O2 and a molecular weight of 489.53 g/mol. Its IUPAC name is 5-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155295580 |
| Molecular Formula | C27H25F2N5O2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CCC5NCCO[C@@H]5C4)c3c2)c(=O)[nH]1 |
| InChI | InChI=1S/C27H25F2N5O2/c1-15-31-13-22(27(35)33-15)16-2-3-23-20(10-16)26(34-6-4-24-25(14-34)36-7-5-30-24)21(12-32-23)17-8-18(28)11-19(29)9-17/h2-3,8-13,24-25,30H,4-7,14H2,1H3,(H,31,33,35)/t24?,25-/m1/s1 |
| InChIKey | ATQWSRPHRGXUOQ-WUBHUQEYSA-N |
| XLogP | 3.81 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |