C28H24F2N6O — CID 134168322
2-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-3-aminopyridine-4-carbonitrile (PubChem CID 134168322) has the molecular formula C28H24F2N6O and a molecular weight of 498.54 g/mol. Its IUPAC name is 2-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-3-aminopyridine-4-carbonitrile.
| Compound Name | 2-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-3-aminopyridine-4-carbonitrile |
|---|---|
| PubChem CID | 134168322 |
| Molecular Formula | C28H24F2N6O |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 2-[4-[(4aR,8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-3-aminopyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CC[C@H]5NCCO[C@@H]5C4)c3c2)c1N |
| InChI | InChI=1S/C28H24F2N6O/c29-19-9-18(10-20(30)12-19)22-14-35-23-2-1-16(27-26(32)17(13-31)3-5-34-27)11-21(23)28(22)36-7-4-24-25(15-36)37-8-6-33-24/h1-3,5,9-12,14,24-25,33H,4,6-8,15,32H2/t24-,25-/m1/s1 |
| InChIKey | MVWLXFGLOGAICA-JWQCQUIFSA-N |
| XLogP | 4.26 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |