C29H25F2N5O — CID 153295476
2-[4-[(8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-4-ethynylpyridin-3-amine (PubChem CID 153295476) has the molecular formula C29H25F2N5O and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[4-[(8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-4-ethynylpyridin-3-amine.
| Compound Name | 2-[4-[(8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-4-ethynylpyridin-3-amine |
|---|---|
| PubChem CID | 153295476 |
| Molecular Formula | C29H25F2N5O |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[4-[(8aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-4-ethynylpyridin-3-amine |
| SMILES | C#Cc1ccnc(-c2ccc3ncc(-c4cc(F)cc(F)c4)c(N4CC[C@H]5NCCOC5C4)c3c2)c1N |
| InChI | InChI=1S/C29H25F2N5O/c1-2-17-5-7-34-28(27(17)32)18-3-4-24-22(13-18)29(36-9-6-25-26(16-36)37-10-8-33-25)23(15-35-24)19-11-20(30)14-21(31)12-19/h1,3-5,7,11-15,25-26,33H,6,8-10,16,32H2/t25-,26?/m1/s1 |
| InChIKey | CLLXGBPIKNBMHR-DCWQJPKNSA-N |
| XLogP | 4.37 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|