C28H26FN7O — CID 134255296
2-[5-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-6-(3-fluoro-5-methylphenyl)-1,8-naphthyridin-3-yl]-3-aminopyridine-4-carbonitrile (PubChem CID 134255296) has the molecular formula C28H26FN7O and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-[5-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-6-(3-fluoro-5-methylphenyl)-1,8-naphthyridin-3-yl]-3-aminopyridine-4-carbonitrile.
| Compound Name | 2-[5-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-6-(3-fluoro-5-methylphenyl)-1,8-naphthyridin-3-yl]-3-aminopyridine-4-carbonitrile |
|---|---|
| PubChem CID | 134255296 |
| Molecular Formula | C28H26FN7O |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 2-[5-(1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl)-6-(3-fluoro-5-methylphenyl)-1,8-naphthyridin-3-yl]-3-aminopyridine-4-carbonitrile |
| SMILES | Cc1cc(F)cc(-c2cnc3ncc(-c4nccc(C#N)c4N)cc3c2N2CCC3NCCOC3C2)c1 |
| InChI | InChI=1S/C28H26FN7O/c1-16-8-18(10-20(29)9-16)22-14-35-28-21(27(22)36-6-3-23-24(15-36)37-7-5-32-23)11-19(13-34-28)26-25(31)17(12-30)2-4-33-26/h2,4,8-11,13-14,23-24,32H,3,5-7,15,31H2,1H3 |
| InChIKey | SDMUWOPDWHTKHB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |