C26H24Cl2N6O — CID 145443489
3-[5-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-6-(3,5-dichlorophenyl)-1,8-naphthyridin-3-yl]pyridin-2-amine (PubChem CID 145443489) has the molecular formula C26H24Cl2N6O and a molecular weight of 507.43 g/mol. Its IUPAC name is 3-[5-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-6-(3,5-dichlorophenyl)-1,8-naphthyridin-3-yl]pyridin-2-amine.
| Compound Name | 3-[5-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-6-(3,5-dichlorophenyl)-1,8-naphthyridin-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 145443489 |
| Molecular Formula | C26H24Cl2N6O |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 3-[5-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-6-(3,5-dichlorophenyl)-1,8-naphthyridin-3-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cnc2ncc(-c3cc(Cl)cc(Cl)c3)c(N3CC[C@@H]4NCCO[C@H]4C3)c2c1 |
| InChI | InChI=1S/C26H24Cl2N6O/c27-17-8-15(9-18(28)11-17)21-13-33-26-20(10-16(12-32-26)19-2-1-4-31-25(19)29)24(21)34-6-3-22-23(14-34)35-7-5-30-22/h1-2,4,8-13,22-23,30H,3,5-7,14H2,(H2,29,31)/t22-,23-/m0/s1 |
| InChIKey | BIPOULPVMFFSNS-GOTSBHOMSA-N |
| XLogP | 4.81 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |