C27H23FN4O — CID 176911248
3-[3-(3-fluoro-5-methylphenyl)-4-piperazin-1-ylquinolin-6-yl]-2-hydroxybenzonitrile (PubChem CID 176911248) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is 3-[3-(3-fluoro-5-methylphenyl)-4-piperazin-1-ylquinolin-6-yl]-2-hydroxybenzonitrile.
| Compound Name | 3-[3-(3-fluoro-5-methylphenyl)-4-piperazin-1-ylquinolin-6-yl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 176911248 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-[3-(3-fluoro-5-methylphenyl)-4-piperazin-1-ylquinolin-6-yl]-2-hydroxybenzonitrile |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4cccc(C#N)c4O)cc3c2N2CCNCC2)c1 |
| InChI | InChI=1S/C27H23FN4O/c1-17-11-20(13-21(28)12-17)24-16-31-25-6-5-18(22-4-2-3-19(15-29)27(22)33)14-23(25)26(24)32-9-7-30-8-10-32/h2-6,11-14,16,30,33H,7-10H2,1H3 |
| InChIKey | AVPHDLFELGNFIG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |