C26H23FN4O2 — CID 134179832
3-[3-(3-fluorocyclopenta-1,3-dien-1-yl)-4-[4-(hydroxyamino)piperidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile (PubChem CID 134179832) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[3-(3-fluorocyclopenta-1,3-dien-1-yl)-4-[4-(hydroxyamino)piperidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile.
| Compound Name | 3-[3-(3-fluorocyclopenta-1,3-dien-1-yl)-4-[4-(hydroxyamino)piperidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 134179832 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-[3-(3-fluorocyclopenta-1,3-dien-1-yl)-4-[4-(hydroxyamino)piperidin-1-yl]quinolin-6-yl]-2-hydroxybenzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3ncc(C4=CC(F)=CC4)c(N4CCC(NO)CC4)c3c2)c1O |
| InChI | InChI=1S/C26H23FN4O2/c27-19-6-4-16(12-19)23-15-29-24-7-5-17(21-3-1-2-18(14-28)26(21)32)13-22(24)25(23)31-10-8-20(30-33)9-11-31/h1-3,5-7,12-13,15,20,30,32-33H,4,8-11H2 |
| InChIKey | OLXLGOXIKOLYOZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|