C29H26F2N4O3 — CID 145443367
3-[4-[(4R)-4-amino-3-methylpiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-hydroxybenzonitrile;formic acid (PubChem CID 145443367) has the molecular formula C29H26F2N4O3 and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-[4-[(4R)-4-amino-3-methylpiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-hydroxybenzonitrile;formic acid.
| Compound Name | 3-[4-[(4R)-4-amino-3-methylpiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-hydroxybenzonitrile;formic acid |
|---|---|
| PubChem CID | 145443367 |
| Molecular Formula | C29H26F2N4O3 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 3-[4-[(4R)-4-amino-3-methylpiperidin-1-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-2-hydroxybenzonitrile;formic acid |
| SMILES | CC1CN(c2c(-c3cc(F)cc(F)c3)cnc3ccc(-c4cccc(C#N)c4O)cc23)CC[C@H]1N.O=CO |
| InChI | InChI=1S/C28H24F2N4O.CH2O2/c1-16-15-34(8-7-25(16)32)27-23-11-17(22-4-2-3-18(13-31)28(22)35)5-6-26(23)33-14-24(27)19-9-20(29)12-21(30)10-19;2-1-3/h2-6,9-12,14,16,25,35H,7-8,15,32H2,1H3;1H,(H,2,3)/t16?,25-;/m1./s1 |
| InChIKey | FAONXCCDHNGOIS-IJAQIYQGSA-N |
| XLogP | 5.30 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|