C30H27F6N5O2 — CID 140837120
1-[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-(2,2,2-trifluoroethoxy)urea (PubChem CID 140837120) has the molecular formula C30H27F6N5O2 and a molecular weight of 603.57 g/mol. Its IUPAC name is 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-(2,2,2-trifluoroethoxy)urea.
| Compound Name | 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-(2,2,2-trifluoroethoxy)urea |
|---|---|
| PubChem CID | 140837120 |
| Molecular Formula | C30H27F6N5O2 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3-fluoro-5-methylphenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-(2,2,2-trifluoroethoxy)urea |
| SMILES | Cc1cc(F)cc(-c2cnc3ccc(-c4cc(F)cc(F)c4NC(=O)NOCC(F)(F)F)cc3c2N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C30H27F6N5O2/c1-16-8-18(10-19(31)9-16)24-14-38-26-3-2-17(11-23(26)28(24)41-6-4-21(37)5-7-41)22-12-20(32)13-25(33)27(22)39-29(42)40-43-15-30(34,35)36/h2-3,8-14,21H,4-7,15,37H2,1H3,(H2,39,40,42) |
| InChIKey | PHGVDLAVWUVGMC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|