C28H33FN6O — CID 140836900
1-[3-(3-fluoro-5-methylphenyl)-6-[3-(2-methoxyethylamino)-1-methylpyrazol-4-yl]quinolin-4-yl]piperidin-4-amine (PubChem CID 140836900) has the molecular formula C28H33FN6O and a molecular weight of 488.61 g/mol. Its IUPAC name is 1-[3-(3-fluoro-5-methylphenyl)-6-[3-(2-methoxyethylamino)-1-methylpyrazol-4-yl]quinolin-4-yl]piperidin-4-amine.
| Compound Name | 1-[3-(3-fluoro-5-methylphenyl)-6-[3-(2-methoxyethylamino)-1-methylpyrazol-4-yl]quinolin-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 140836900 |
| Molecular Formula | C28H33FN6O |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-[3-(3-fluoro-5-methylphenyl)-6-[3-(2-methoxyethylamino)-1-methylpyrazol-4-yl]quinolin-4-yl]piperidin-4-amine |
| SMILES | COCCNc1nn(C)cc1-c1ccc2ncc(-c3cc(C)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C28H33FN6O/c1-18-12-20(14-21(29)13-18)24-16-32-26-5-4-19(25-17-34(2)33-28(25)31-8-11-36-3)15-23(26)27(24)35-9-6-22(30)7-10-35/h4-5,12-17,22H,6-11,30H2,1-3H3,(H,31,33) |
| InChIKey | VUYLLVCHAXEHRS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|