C34H33F3N4O4 — CID 140836899
tert-butyl N-[1-[6-[3-cyano-2-(methoxymethoxy)phenyl]-3-(3,5-difluorophenyl)quinolin-4-yl]-3-fluoropiperidin-4-yl]carbamate (PubChem CID 140836899) has the molecular formula C34H33F3N4O4 and a molecular weight of 618.66 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[3-cyano-2-(methoxymethoxy)phenyl]-3-(3,5-difluorophenyl)quinolin-4-yl]-3-fluoropiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-[3-cyano-2-(methoxymethoxy)phenyl]-3-(3,5-difluorophenyl)quinolin-4-yl]-3-fluoropiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 140836899 |
| Molecular Formula | C34H33F3N4O4 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | tert-butyl N-[1-[6-[3-cyano-2-(methoxymethoxy)phenyl]-3-(3,5-difluorophenyl)quinolin-4-yl]-3-fluoropiperidin-4-yl]carbamate |
| SMILES | COCOc1c(C#N)cccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC(NC(=O)OC(C)(C)C)C(F)C3)c2c1 |
| InChI | InChI=1S/C34H33F3N4O4/c1-34(2,3)45-33(42)40-30-10-11-41(18-28(30)37)31-26-14-20(25-7-5-6-21(16-38)32(25)44-19-43-4)8-9-29(26)39-17-27(31)22-12-23(35)15-24(36)13-22/h5-9,12-15,17,28,30H,10-11,18-19H2,1-4H3,(H,40,42) |
| InChIKey | UDOBUKWDYAIDEX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 96.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|