C17H17NO5 — CID 134180652
1-[3-methoxy-4-(methoxymethoxy)phenyl]-3-pyridin-4-ylpropane-1,3-dione (PubChem CID 134180652) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-[3-methoxy-4-(methoxymethoxy)phenyl]-3-pyridin-4-ylpropane-1,3-dione.
| Compound Name | 1-[3-methoxy-4-(methoxymethoxy)phenyl]-3-pyridin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 134180652 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[3-methoxy-4-(methoxymethoxy)phenyl]-3-pyridin-4-ylpropane-1,3-dione |
| SMILES | COCOc1ccc(C(=O)CC(=O)c2ccncc2)cc1OC |
| InChI | InChI=1S/C17H17NO5/c1-21-11-23-16-4-3-13(9-17(16)22-2)15(20)10-14(19)12-5-7-18-8-6-12/h3-9H,10-11H2,1-2H3 |
| InChIKey | GWWBEKLRAWBQQL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|