C6H12N2 — CID 134182090
(Z)-N,N-dimethyl-1-(methylideneamino)prop-1-en-2-amine (PubChem CID 134182090) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-1-(methylideneamino)prop-1-en-2-amine.
| Compound Name | (Z)-N,N-dimethyl-1-(methylideneamino)prop-1-en-2-amine |
|---|---|
| PubChem CID | 134182090 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (Z)-N,N-dimethyl-1-(methylideneamino)prop-1-en-2-amine |
| SMILES | C=N/C=C(/C)N(C)C |
| InChI | InChI=1S/C6H12N2/c1-6(5-7-2)8(3)4/h5H,2H2,1,3-4H3/b6-5- |
| InChIKey | FLQNRYZQXIWLRR-WAYWQWQTSA-N |
| XLogP | 1.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|