C13H19Cl3N2O2 — CID 134182986
ethyl (E)-3-chloro-3-[[(Z)-1,1-dichlorohex-3-enyl]-methylamino]-2-(methylideneamino)prop-2-enoate (PubChem CID 134182986) has the molecular formula C13H19Cl3N2O2 and a molecular weight of 341.67 g/mol. Its IUPAC name is ethyl (E)-3-chloro-3-[[(Z)-1,1-dichlorohex-3-enyl]-methylamino]-2-(methylideneamino)prop-2-enoate.
| Compound Name | ethyl (E)-3-chloro-3-[[(Z)-1,1-dichlorohex-3-enyl]-methylamino]-2-(methylideneamino)prop-2-enoate |
|---|---|
| PubChem CID | 134182986 |
| Molecular Formula | C13H19Cl3N2O2 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | ethyl (E)-3-chloro-3-[[(Z)-1,1-dichlorohex-3-enyl]-methylamino]-2-(methylideneamino)prop-2-enoate |
| SMILES | C=N/C(C(=O)OCC)=C(/Cl)N(C)C(Cl)(Cl)C/C=C\CC |
| InChI | InChI=1S/C13H19Cl3N2O2/c1-5-7-8-9-13(15,16)18(4)11(14)10(17-3)12(19)20-6-2/h7-8H,3,5-6,9H2,1-2,4H3/b8-7-,11-10- |
| InChIKey | AALXMGKDFQVSFZ-NQLNTKRDSA-N |
| XLogP | 4.08 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|