C10H11ClN4O2 — CID 135007288
ethyl 2-[[chloro(dimethylamino)methylidene]amino]-3,3-dicyanoprop-2-enoate (PubChem CID 135007288) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is ethyl 2-[[chloro(dimethylamino)methylidene]amino]-3,3-dicyanoprop-2-enoate.
| Compound Name | ethyl 2-[[chloro(dimethylamino)methylidene]amino]-3,3-dicyanoprop-2-enoate |
|---|---|
| PubChem CID | 135007288 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | ethyl 2-[[chloro(dimethylamino)methylidene]amino]-3,3-dicyanoprop-2-enoate |
| SMILES | CCOC(=O)C(/N=C(\Cl)N(C)C)=C(C#N)C#N |
| InChI | InChI=1S/C10H11ClN4O2/c1-4-17-9(16)8(7(5-12)6-13)14-10(11)15(2)3/h4H2,1-3H3/b14-10+ |
| InChIKey | SUKWXCYRRTVSBD-GXDHUFHOSA-N |
| XLogP | 1.01 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|