C25H36N2O4 — CID 134188626
tert-butyl 4-[[5-(2-methoxyethylcarbamoyl)-6-methyl-2H-inden-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 134188626) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl 4-[[5-(2-methoxyethylcarbamoyl)-6-methyl-2H-inden-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(2-methoxyethylcarbamoyl)-6-methyl-2H-inden-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134188626 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl 4-[[5-(2-methoxyethylcarbamoyl)-6-methyl-2H-inden-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | COCCNC(=O)c1cc2c(cc1C)=CC(CC1CCN(C(=O)OC(C)(C)C)CC1)C=2 |
| InChI | InChI=1S/C25H36N2O4/c1-17-12-20-14-19(15-21(20)16-22(17)23(28)26-8-11-30-5)13-18-6-9-27(10-7-18)24(29)31-25(2,3)4/h12,14-16,18-19H,6-11,13H2,1-5H3,(H,26,28) |
| InChIKey | MMXQVFWPKWEPQD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|