C32H48N4O3 — CID 134189164
(Z)-N'-[1-[2-(cyclopropylmethyl)-7a-ethyl-4a-(2-ethyl-5-hydroxyphenyl)-1-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-5-yl]propyl]-4-imino-N'-methylpent-2-enediamide (PubChem CID 134189164) has the molecular formula C32H48N4O3 and a molecular weight of 536.76 g/mol. Its IUPAC name is (Z)-N'-[1-[2-(cyclopropylmethyl)-7a-ethyl-4a-(2-ethyl-5-hydroxyphenyl)-1-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-5-yl]propyl]-4-imino-N'-methylpent-2-enediamide.
| Compound Name | (Z)-N'-[1-[2-(cyclopropylmethyl)-7a-ethyl-4a-(2-ethyl-5-hydroxyphenyl)-1-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-5-yl]propyl]-4-imino-N'-methylpent-2-enediamide |
|---|---|
| PubChem CID | 134189164 |
| Molecular Formula | C32H48N4O3 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | (Z)-N'-[1-[2-(cyclopropylmethyl)-7a-ethyl-4a-(2-ethyl-5-hydroxyphenyl)-1-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-5-yl]propyl]-4-imino-N'-methylpent-2-enediamide |
| SMILES | [H]/N=C(/C=C\C(N)=O)C(=O)N(C)C(CC)C1CCC2(CC)C(C)N(CC3CC3)CCC12c1cc(O)ccc1CC |
| InChI | InChI=1S/C32H48N4O3/c1-6-23-11-12-24(37)19-26(23)32-17-18-36(20-22-9-10-22)21(4)31(32,8-3)16-15-25(32)28(7-2)35(5)30(39)27(33)13-14-29(34)38/h11-14,19,21-22,25,28,33,37H,6-10,15-18,20H2,1-5H3,(H2,34,38)/b14-13-,33-27- |
| InChIKey | CLYHWGCSLJRKAZ-LZTILWGQSA-N |
| XLogP | 4.80 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|