C30H40N2O4 — CID 139332620
[(1E,3Z)-2-[1-[16-(cyclopropylmethyl)-4-hydroxy-10-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-13-yl]ethyl-methylcarbamoyl]penta-1,3-dienyl] formate (PubChem CID 139332620) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is [(1E,3Z)-2-[1-[16-(cyclopropylmethyl)-4-hydroxy-10-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-13-yl]ethyl-methylcarbamoyl]penta-1,3-dienyl] formate.
| Compound Name | [(1E,3Z)-2-[1-[16-(cyclopropylmethyl)-4-hydroxy-10-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-13-yl]ethyl-methylcarbamoyl]penta-1,3-dienyl] formate |
|---|---|
| PubChem CID | 139332620 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | [(1E,3Z)-2-[1-[16-(cyclopropylmethyl)-4-hydroxy-10-methyl-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-13-yl]ethyl-methylcarbamoyl]penta-1,3-dienyl] formate |
| SMILES | C/C=C\C(=C/OC=O)C(=O)N(C)C(C)C1CCC2(C)C3Cc4ccc(O)cc4C12CCN3CC1CC1 |
| InChI | InChI=1S/C30H40N2O4/c1-5-6-23(18-36-19-33)28(35)31(4)20(2)25-11-12-29(3)27-15-22-9-10-24(34)16-26(22)30(25,29)13-14-32(27)17-21-7-8-21/h5-6,9-10,16,18-21,25,27,34H,7-8,11-15,17H2,1-4H3/b6-5-,23-18+ |
| InChIKey | FYFVNNKBOBGTEY-UINBHVBHSA-N |
| XLogP | 4.57 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|