C12H10ClN3O — CID 134189445
11-chloro-5-ethoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 134189445) has the molecular formula C12H10ClN3O and a molecular weight of 247.69 g/mol. Its IUPAC name is 11-chloro-5-ethoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 11-chloro-5-ethoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 134189445 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 11-chloro-5-ethoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CCOc1cc2[nH]c3nc(Cl)ccc3c2cn1 |
| InChI | InChI=1S/C12H10ClN3O/c1-2-17-11-5-9-8(6-14-11)7-3-4-10(13)16-12(7)15-9/h3-6H,2H2,1H3,(H,15,16) |
| InChIKey | NCJJUTKBVIRMMM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|