C12H27FO7P2S — CID 134189837
[3-dimethylphosphoryl-3-di(propan-2-yloxy)phosphoryl-3-fluoropropyl] methanesulfonate (PubChem CID 134189837) has the molecular formula C12H27FO7P2S and a molecular weight of 396.35 g/mol. Its IUPAC name is [3-dimethylphosphoryl-3-di(propan-2-yloxy)phosphoryl-3-fluoropropyl] methanesulfonate.
| Compound Name | [3-dimethylphosphoryl-3-di(propan-2-yloxy)phosphoryl-3-fluoropropyl] methanesulfonate |
|---|---|
| PubChem CID | 134189837 |
| Molecular Formula | C12H27FO7P2S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [3-dimethylphosphoryl-3-di(propan-2-yloxy)phosphoryl-3-fluoropropyl] methanesulfonate |
| SMILES | CC(C)OP(=O)(OC(C)C)C(F)(CCOS(C)(=O)=O)P(C)(C)=O |
| InChI | InChI=1S/C12H27FO7P2S/c1-10(2)19-22(15,20-11(3)4)12(13,21(5,6)14)8-9-18-23(7,16)17/h10-11H,8-9H2,1-7H3 |
| InChIKey | OVEDGTOZNQHPMP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|