C38H31N2OP — CID 134194170
10-[3-(2-diphenylphosphoryl-4-pyridinyl)phenyl]-9,9-dimethylacridine (PubChem CID 134194170) has the molecular formula C38H31N2OP and a molecular weight of 562.65 g/mol. Its IUPAC name is 10-[3-(2-diphenylphosphoryl-4-pyridinyl)phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[3-(2-diphenylphosphoryl-4-pyridinyl)phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 134194170 |
| Molecular Formula | C38H31N2OP |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 10-[3-(2-diphenylphosphoryl-4-pyridinyl)phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2cccc(-c3ccnc(P(=O)(c4ccccc4)c4ccccc4)c3)c2)c2ccccc21 |
| InChI | InChI=1S/C38H31N2OP/c1-38(2)33-20-9-11-22-35(33)40(36-23-12-10-21-34(36)38)30-15-13-14-28(26-30)29-24-25-39-37(27-29)42(41,31-16-5-3-6-17-31)32-18-7-4-8-19-32/h3-27H,1-2H3 |
| InChIKey | HSUAABORMRFNDC-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|