C57H47N3O2P2 — CID 135193037
9,9-dimethyl-10-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]acridine (PubChem CID 135193037) has the molecular formula C57H47N3O2P2 and a molecular weight of 867.97 g/mol. Its IUPAC name is 9,9-dimethyl-10-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]acridine.
| Compound Name | 9,9-dimethyl-10-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]acridine |
|---|---|
| PubChem CID | 135193037 |
| Molecular Formula | C57H47N3O2P2 |
| Molecular Weight | 867.97 g/mol |
| Exact Mass | 867.31 |
| IUPAC Name | 9,9-dimethyl-10-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]acridine |
| SMILES | Cc1ncc(-c2cccc(P(=O)(c3ccccc3)c3ccccc3Cc3ccccc3P(=O)(c3ccccc3)c3cccc(N4c5ccccc5C(C)(C)c5ccccc54)c3)c2)cn1 |
| InChI | InChI=1S/C57H47N3O2P2/c1-41-58-39-45(40-59-41)42-22-18-28-49(37-42)63(61,47-24-6-4-7-25-47)55-34-16-10-20-43(55)36-44-21-11-17-35-56(44)64(62,48-26-8-5-9-27-48)50-29-19-23-46(38-50)60-53-32-14-12-30-51(53)57(2,3)52-31-13-15-33-54(52)60/h4-35,37-40H,36H2,1-3H3 |
| InChIKey | MDBMTSHFTIUEOI-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.97 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|