C47H40N3OP — CID 134194182
10-[3-(9,9-dimethylacridin-10-yl)-5-[phenyl(pyridin-3-yl)phosphoryl]phenyl]-9,9-dimethylacridine (PubChem CID 134194182) has the molecular formula C47H40N3OP and a molecular weight of 693.83 g/mol. Its IUPAC name is 10-[3-(9,9-dimethylacridin-10-yl)-5-[phenyl(pyridin-3-yl)phosphoryl]phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[3-(9,9-dimethylacridin-10-yl)-5-[phenyl(pyridin-3-yl)phosphoryl]phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 134194182 |
| Molecular Formula | C47H40N3OP |
| Molecular Weight | 693.83 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | 10-[3-(9,9-dimethylacridin-10-yl)-5-[phenyl(pyridin-3-yl)phosphoryl]phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2cc(N3c4ccccc4C(C)(C)c4ccccc43)cc(P(=O)(c3ccccc3)c3cccnc3)c2)c2ccccc21 |
| InChI | InChI=1S/C47H40N3OP/c1-46(2)38-20-8-12-24-42(38)49(43-25-13-9-21-39(43)46)33-29-34(50-44-26-14-10-22-40(44)47(3,4)41-23-11-15-27-45(41)50)31-37(30-33)52(51,35-17-6-5-7-18-35)36-19-16-28-48-32-36/h5-32H,1-4H3 |
| InChIKey | XCQPQXWHARVZCV-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.83 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|