C53H45N — CID 134194251
N-(4-anthracen-9-yl-3-phenylphenyl)-N-[(2E,4Z,7E,9Z)-dodeca-2,4,7,9,11-pentaen-3-yl]-9,9-dimethylfluoren-2-amine (PubChem CID 134194251) has the molecular formula C53H45N and a molecular weight of 695.95 g/mol. Its IUPAC name is N-(4-anthracen-9-yl-3-phenylphenyl)-N-[(2E,4Z,7E,9Z)-dodeca-2,4,7,9,11-pentaen-3-yl]-9,9-dimethylfluoren-2-amine.
| Compound Name | N-(4-anthracen-9-yl-3-phenylphenyl)-N-[(2E,4Z,7E,9Z)-dodeca-2,4,7,9,11-pentaen-3-yl]-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 134194251 |
| Molecular Formula | C53H45N |
| Molecular Weight | 695.95 g/mol |
| Exact Mass | 695.36 |
| IUPAC Name | N-(4-anthracen-9-yl-3-phenylphenyl)-N-[(2E,4Z,7E,9Z)-dodeca-2,4,7,9,11-pentaen-3-yl]-9,9-dimethylfluoren-2-amine |
| SMILES | C=C/C=C\C=C\C/C=C\C(=C/C)N(c1ccc(-c2c3ccccc3cc3ccccc23)c(-c2ccccc2)c1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C53H45N/c1-5-7-8-9-10-11-15-26-41(6-2)54(43-31-33-47-46-29-20-21-30-50(46)53(3,4)51(47)37-43)42-32-34-48(49(36-42)38-22-13-12-14-23-38)52-44-27-18-16-24-39(44)35-40-25-17-19-28-45(40)52/h5-10,12-37H,1,11H2,2-4H3/b8-7-,10-9+,26-15-,41-6+ |
| InChIKey | HOGGSCOLLKNPDC-LKZVASSKSA-N |
| XLogP | 14.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.95 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|