C35H31N — CID 146644000
9,9-dimethyl-N-[(3Z,5E)-octa-1,3,5,7-tetraen-3-yl]-N-(2-phenylphenyl)fluoren-3-amine (PubChem CID 146644000) has the molecular formula C35H31N and a molecular weight of 465.64 g/mol. Its IUPAC name is 9,9-dimethyl-N-[(3Z,5E)-octa-1,3,5,7-tetraen-3-yl]-N-(2-phenylphenyl)fluoren-3-amine.
| Compound Name | 9,9-dimethyl-N-[(3Z,5E)-octa-1,3,5,7-tetraen-3-yl]-N-(2-phenylphenyl)fluoren-3-amine |
|---|---|
| PubChem CID | 146644000 |
| Molecular Formula | C35H31N |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 9,9-dimethyl-N-[(3Z,5E)-octa-1,3,5,7-tetraen-3-yl]-N-(2-phenylphenyl)fluoren-3-amine |
| SMILES | C=C/C=C/C=C(/C=C)N(c1ccc2c(c1)-c1ccccc1C2(C)C)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C35H31N/c1-5-7-9-18-27(6-2)36(34-22-15-13-19-29(34)26-16-10-8-11-17-26)28-23-24-33-31(25-28)30-20-12-14-21-32(30)35(33,3)4/h5-25H,1-2H2,3-4H3/b9-7+,27-18- |
| InChIKey | XINFTCIUSYCJAO-MDDLKKHHSA-N |
| XLogP | 9.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|